About [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-phenylmethanone
[4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-phenylmethanone (PubChem CID 3124468) has the molecular formula C25H24ClNO
and a molecular weight of 389.93 g/mol. Its IUPAC name is [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-phenylmethanone |
| PubChem CID | 3124468 |
| Molecular Formula | C25H24ClNO |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-phenylmethanone |
| SMILES | CC1(c2ccc(Cl)cc2)CC(C)(C)N(C(=O)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C25H24ClNO/c1-24(2)17-25(3,19-13-15-20(26)16-14-19)21-11-7-8-12-22(21)27(24)23(28)18-9-5-4-6-10-18/h4-16H,17H2,1-3H3 |
| InChIKey | OPIOQEXYTWWMKZ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-phenylmethanone?
The IUPAC name of [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-phenylmethanone (CID 3124468) is [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-phenylmethanone.
What is the SMILES notation for [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-phenylmethanone?
The canonical SMILES for [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-phenylmethanone is CC1(c2ccc(Cl)cc2)CC(C)(C)N(C(=O)c2ccccc2)c2ccccc21.
What is the InChIKey of [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-phenylmethanone?
The InChIKey is OPIOQEXYTWWMKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24ClNO/c1-24(2)17-25(3,19-13-15-20(26)16-14-19)21-11-7-8-12-22(21)27(24)23(28)18-9-5-4-6-10-18/h4-16H,17H2,1-3H3.
What are the key properties of [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-phenylmethanone?
[4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-phenylmethanone has a molecular weight of 389.93 g/mol, XLogP of 6.48, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-phenylmethanone is sourced from PubChem (CID 3124468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).