C14H18ClN3O4 — CID 37230322
methyl 2-chloro-5-[[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl]amino]benzoate (PubChem CID 37230322) has the molecular formula C14H18ClN3O4 and a molecular weight of 327.77 g/mol. Its IUPAC name is methyl 2-chloro-5-[[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl]amino]benzoate |
|---|---|
| PubChem CID | 37230322 |
| Molecular Formula | C14H18ClN3O4 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | methyl 2-chloro-5-[[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NCC(=O)NC(=O)NC(C)C)ccc1Cl |
| InChI | InChI=1S/C14H18ClN3O4/c1-8(2)17-14(21)18-12(19)7-16-9-4-5-11(15)10(6-9)13(20)22-3/h4-6,8,16H,7H2,1-3H3,(H2,17,18,19,21) |
| InChIKey | WUIATAFMBTUKTO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |