About 2-[[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methyl]-4-phenylquinazoline
2-[[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methyl]-4-phenylquinazoline (PubChem CID 37254305) has the molecular formula C28H30N4O2
and a molecular weight of 454.57 g/mol. Its IUPAC name is 2-[[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methyl]-4-phenylquinazoline.
Molecular Properties
| Compound Name | 2-[[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methyl]-4-phenylquinazoline |
| PubChem CID | 37254305 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 2-[[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methyl]-4-phenylquinazoline |
| SMILES | COc1ccc(CN2CCN(Cc3nc(-c4ccccc4)c4ccccc4n3)CC2)cc1OC |
| InChI | InChI=1S/C28H30N4O2/c1-33-25-13-12-21(18-26(25)34-2)19-31-14-16-32(17-15-31)20-27-29-24-11-7-6-10-23(24)28(30-27)22-8-4-3-5-9-22/h3-13,18H,14-17,19-20H2,1-2H3 |
| InChIKey | SUBIGLNOHMBZKJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methyl]-4-phenylquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methyl]-4-phenylquinazoline?
The IUPAC name of 2-[[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methyl]-4-phenylquinazoline (CID 37254305) is 2-[[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methyl]-4-phenylquinazoline.
What is the SMILES notation for 2-[[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methyl]-4-phenylquinazoline?
The canonical SMILES for 2-[[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methyl]-4-phenylquinazoline is COc1ccc(CN2CCN(Cc3nc(-c4ccccc4)c4ccccc4n3)CC2)cc1OC.
What is the InChIKey of 2-[[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methyl]-4-phenylquinazoline?
The InChIKey is SUBIGLNOHMBZKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H30N4O2/c1-33-25-13-12-21(18-26(25)34-2)19-31-14-16-32(17-15-31)20-27-29-24-11-7-6-10-23(24)28(30-27)22-8-4-3-5-9-22/h3-13,18H,14-17,19-20H2,1-2H3.
What are the key properties of 2-[[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methyl]-4-phenylquinazoline?
2-[[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methyl]-4-phenylquinazoline has a molecular weight of 454.57 g/mol, XLogP of 4.63, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methyl]-4-phenylquinazoline is sourced from PubChem (CID 37254305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).