C28H35N5O3S — CID 3726957
3-[N-(2-cyanoethyl)-4-[[8-(3-methoxyphenyl)sulfonyl-2,8-diazaspiro[4.5]decan-2-yl]methyl]anilino]propanenitrile (PubChem CID 3726957) has the molecular formula C28H35N5O3S and a molecular weight of 521.69 g/mol. Its IUPAC name is 3-[N-(2-cyanoethyl)-4-[[8-(3-methoxyphenyl)sulfonyl-2,8-diazaspiro[4.5]decan-2-yl]methyl]anilino]propanenitrile.
| Compound Name | 3-[N-(2-cyanoethyl)-4-[[8-(3-methoxyphenyl)sulfonyl-2,8-diazaspiro[4.5]decan-2-yl]methyl]anilino]propanenitrile |
|---|---|
| PubChem CID | 3726957 |
| Molecular Formula | C28H35N5O3S |
| Molecular Weight | 521.69 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | 3-[N-(2-cyanoethyl)-4-[[8-(3-methoxyphenyl)sulfonyl-2,8-diazaspiro[4.5]decan-2-yl]methyl]anilino]propanenitrile |
| SMILES | COc1cccc(S(=O)(=O)N2CCC3(CCN(Cc4ccc(N(CCC#N)CCC#N)cc4)C3)CC2)c1 |
| InChI | InChI=1S/C28H35N5O3S/c1-36-26-5-2-6-27(21-26)37(34,35)33-19-12-28(13-20-33)11-18-31(23-28)22-24-7-9-25(10-8-24)32(16-3-14-29)17-4-15-30/h2,5-10,21H,3-4,11-13,16-20,22-23H2,1H3 |
| InChIKey | CJOHIVKEERRNKA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 100.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.69 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|