C27H34N6O2 — CID 3870854
3-[N-(2-cyanoethyl)-4-[[8-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]methyl]anilino]propanenitrile (PubChem CID 3870854) has the molecular formula C27H34N6O2 and a molecular weight of 474.61 g/mol. Its IUPAC name is 3-[N-(2-cyanoethyl)-4-[[8-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]methyl]anilino]propanenitrile.
| Compound Name | 3-[N-(2-cyanoethyl)-4-[[8-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]methyl]anilino]propanenitrile |
|---|---|
| PubChem CID | 3870854 |
| Molecular Formula | C27H34N6O2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | 3-[N-(2-cyanoethyl)-4-[[8-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]methyl]anilino]propanenitrile |
| SMILES | Cc1noc(C)c1C(=O)N1CCC2(CCN(Cc3ccc(N(CCC#N)CCC#N)cc3)C2)CC1 |
| InChI | InChI=1S/C27H34N6O2/c1-21-25(22(2)35-30-21)26(34)33-17-10-27(11-18-33)9-16-31(20-27)19-23-5-7-24(8-6-23)32(14-3-12-28)15-4-13-29/h5-8H,3-4,9-11,14-20H2,1-2H3 |
| InChIKey | AWJGCZXLNFEBKZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 100.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|