C15H21N3O3 — CID 37305986
N-[2-methoxy-5-[[(3S)-2-oxoazepan-3-yl]amino]phenyl]acetamide (PubChem CID 37305986) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-[2-methoxy-5-[[(3S)-2-oxoazepan-3-yl]amino]phenyl]acetamide.
| Compound Name | N-[2-methoxy-5-[[(3S)-2-oxoazepan-3-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 37305986 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-[2-methoxy-5-[[(3S)-2-oxoazepan-3-yl]amino]phenyl]acetamide |
| SMILES | COc1ccc(N[C@H]2CCCCNC2=O)cc1NC(C)=O |
| InChI | InChI=1S/C15H21N3O3/c1-10(19)17-13-9-11(6-7-14(13)21-2)18-12-5-3-4-8-16-15(12)20/h6-7,9,12,18H,3-5,8H2,1-2H3,(H,16,20)(H,17,19)/t12-/m0/s1 |
| InChIKey | VGALDCHUEMZXER-LBPRGKRZSA-N |
| XLogP | 1.73 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|