C12H20O2 — CID 3732384
3,9,11-trimethyl-2,4-dioxaspiro[5.5]undec-8-ene (PubChem CID 3732384) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 3,9,11-trimethyl-2,4-dioxaspiro[5.5]undec-8-ene.
| Compound Name | 3,9,11-trimethyl-2,4-dioxaspiro[5.5]undec-8-ene |
|---|---|
| PubChem CID | 3732384 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 3,9,11-trimethyl-2,4-dioxaspiro[5.5]undec-8-ene |
| SMILES | CC1=CCC2(COC(C)OC2)C(C)C1 |
| InChI | InChI=1S/C12H20O2/c1-9-4-5-12(10(2)6-9)7-13-11(3)14-8-12/h4,10-11H,5-8H2,1-3H3 |
| InChIKey | IDESPEIRNJTAMU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|