C19H24NO3P — CID 3738247
ethyl 2-amino-4-diphenylphosphoryl-2-methylbutanoate (PubChem CID 3738247) has the molecular formula C19H24NO3P and a molecular weight of 345.38 g/mol. Its IUPAC name is ethyl 2-amino-4-diphenylphosphoryl-2-methylbutanoate.
| Compound Name | ethyl 2-amino-4-diphenylphosphoryl-2-methylbutanoate |
|---|---|
| PubChem CID | 3738247 |
| Molecular Formula | C19H24NO3P |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | ethyl 2-amino-4-diphenylphosphoryl-2-methylbutanoate |
| SMILES | CCOC(=O)C(C)(N)CCP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H24NO3P/c1-3-23-18(21)19(2,20)14-15-24(22,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13H,3,14-15,20H2,1-2H3 |
| InChIKey | XSNFMVVBBHTHRD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|