C25H29BrNO2P — CID 134977184
2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-amino-3-methylbutanoate (PubChem CID 134977184) has the molecular formula C25H29BrNO2P and a molecular weight of 486.39 g/mol. Its IUPAC name is 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 134977184 |
| Molecular Formula | C25H29BrNO2P |
| Molecular Weight | 486.39 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 2-[bromo(triphenyl)-λ5-phosphanyl]ethyl (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(C)[C@H](N)C(=O)OCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H29BrNO2P/c1-20(2)24(27)25(28)29-18-19-30(26,21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-17,20,24H,18-19,27H2,1-2H3/t24-/m0/s1 |
| InChIKey | WACRTTSRVXCAAH-DEOSSOPVSA-N |
| XLogP | 4.35 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|