C19H18ClN5O3S — CID 3740723
2-chloro-N-[4-[2-[(4-methoxyphenyl)methylidene]hydrazinyl]-6-methylpyrimidin-2-yl]benzenesulfonamide (PubChem CID 3740723) has the molecular formula C19H18ClN5O3S and a molecular weight of 431.91 g/mol. Its IUPAC name is 2-chloro-N-[4-[2-[(4-methoxyphenyl)methylidene]hydrazinyl]-6-methylpyrimidin-2-yl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[4-[2-[(4-methoxyphenyl)methylidene]hydrazinyl]-6-methylpyrimidin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 3740723 |
| Molecular Formula | C19H18ClN5O3S |
| Molecular Weight | 431.91 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 2-chloro-N-[4-[2-[(4-methoxyphenyl)methylidene]hydrazinyl]-6-methylpyrimidin-2-yl]benzenesulfonamide |
| SMILES | COc1ccc(C=NNc2cc(C)nc(NS(=O)(=O)c3ccccc3Cl)n2)cc1 |
| InChI | InChI=1S/C19H18ClN5O3S/c1-13-11-18(24-21-12-14-7-9-15(28-2)10-8-14)23-19(22-13)25-29(26,27)17-6-4-3-5-16(17)20/h3-12H,1-2H3,(H2,22,23,24,25) |
| InChIKey | NPOIHHJRIANHIG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 105.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.91 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|