C19H20N6O2 — CID 53357332
3-N,5-N-bis[(E)-(4-methoxyphenyl)methylideneamino]-1H-pyrazole-3,5-diamine (PubChem CID 53357332) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is 3-N,5-N-bis[(E)-(4-methoxyphenyl)methylideneamino]-1H-pyrazole-3,5-diamine.
| Compound Name | 3-N,5-N-bis[(E)-(4-methoxyphenyl)methylideneamino]-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 53357332 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 3-N,5-N-bis[(E)-(4-methoxyphenyl)methylideneamino]-1H-pyrazole-3,5-diamine |
| SMILES | COc1ccc(/C=N/Nc2cc(N/N=C/c3ccc(OC)cc3)[nH]n2)cc1 |
| InChI | InChI=1S/C19H20N6O2/c1-26-16-7-3-14(4-8-16)12-20-22-18-11-19(25-24-18)23-21-13-15-5-9-17(27-2)10-6-15/h3-13H,1-2H3,(H3,22,23,24,25)/b20-12+,21-13+ |
| InChIKey | UDHGNEWKAMUKKO-ZIOPAAQOSA-N |
| XLogP | 3.32 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|