C16H14Cl2N4O4S — CID 3741055
1-[[2-[(2,4-dichlorophenyl)methylsulfanyl]acetyl]amino]-3-(3-nitrophenyl)urea (PubChem CID 3741055) has the molecular formula C16H14Cl2N4O4S and a molecular weight of 429.29 g/mol. Its IUPAC name is 1-[[2-[(2,4-dichlorophenyl)methylsulfanyl]acetyl]amino]-3-(3-nitrophenyl)urea.
| Compound Name | 1-[[2-[(2,4-dichlorophenyl)methylsulfanyl]acetyl]amino]-3-(3-nitrophenyl)urea |
|---|---|
| PubChem CID | 3741055 |
| Molecular Formula | C16H14Cl2N4O4S |
| Molecular Weight | 429.29 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | 1-[[2-[(2,4-dichlorophenyl)methylsulfanyl]acetyl]amino]-3-(3-nitrophenyl)urea |
| SMILES | O=C(CSCc1ccc(Cl)cc1Cl)NNC(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H14Cl2N4O4S/c17-11-5-4-10(14(18)6-11)8-27-9-15(23)20-21-16(24)19-12-2-1-3-13(7-12)22(25)26/h1-7H,8-9H2,(H,20,23)(H2,19,21,24) |
| InChIKey | KMSZJJQSUUCTRT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|