C15H17FN2O4S — CID 37438823
5-(4-fluorophenyl)-N-[3-(methanesulfonamido)propyl]furan-2-carboxamide (PubChem CID 37438823) has the molecular formula C15H17FN2O4S and a molecular weight of 340.38 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-[3-(methanesulfonamido)propyl]furan-2-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-[3-(methanesulfonamido)propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 37438823 |
| Molecular Formula | C15H17FN2O4S |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 5-(4-fluorophenyl)-N-[3-(methanesulfonamido)propyl]furan-2-carboxamide |
| SMILES | CS(=O)(=O)NCCCNC(=O)c1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C15H17FN2O4S/c1-23(20,21)18-10-2-9-17-15(19)14-8-7-13(22-14)11-3-5-12(16)6-4-11/h3-8,18H,2,9-10H2,1H3,(H,17,19) |
| InChIKey | WUTIILFDEGSLMK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|