C10H9N3O3S2 — CID 3746334
3-[(4-nitroanilino)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3746334) has the molecular formula C10H9N3O3S2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 3-[(4-nitroanilino)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-[(4-nitroanilino)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3746334 |
| Molecular Formula | C10H9N3O3S2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 3-[(4-nitroanilino)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(=S)N1CNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H9N3O3S2/c14-9-5-18-10(17)12(9)6-11-7-1-3-8(4-2-7)13(15)16/h1-4,11H,5-6H2 |
| InChIKey | ITGMNTCBOZXVNU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|