C12H12N4O3S2 — CID 14344654
N-[4-(2-formylhydrazinyl)phenyl]-2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetamide (PubChem CID 14344654) has the molecular formula C12H12N4O3S2 and a molecular weight of 324.39 g/mol. Its IUPAC name is N-[4-(2-formylhydrazinyl)phenyl]-2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetamide.
| Compound Name | N-[4-(2-formylhydrazinyl)phenyl]-2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 14344654 |
| Molecular Formula | C12H12N4O3S2 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | N-[4-(2-formylhydrazinyl)phenyl]-2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetamide |
| SMILES | O=CNNc1ccc(NC(=O)CN2C(=O)CSC2=S)cc1 |
| InChI | InChI=1S/C12H12N4O3S2/c17-7-13-15-9-3-1-8(2-4-9)14-10(18)5-16-11(19)6-21-12(16)20/h1-4,7,15H,5-6H2,(H,13,17)(H,14,18) |
| InChIKey | CQMOYTQEBIFBHC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|