C11H9FN2O2S2 — CID 110858692
N-(4-fluorophenyl)-2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetamide (PubChem CID 110858692) has the molecular formula C11H9FN2O2S2 and a molecular weight of 284.34 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetamide.
| Compound Name | N-(4-fluorophenyl)-2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 110858692 |
| Molecular Formula | C11H9FN2O2S2 |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | N-(4-fluorophenyl)-2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetamide |
| SMILES | O=C(CN1C(=O)CSC1=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C11H9FN2O2S2/c12-7-1-3-8(4-2-7)13-9(15)5-14-10(16)6-18-11(14)17/h1-4H,5-6H2,(H,13,15) |
| InChIKey | GIQIPSRSWUVOFR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|