C11H8Cl2N2O2S2 — CID 110864228
N-(3,5-dichlorophenyl)-2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetamide (PubChem CID 110864228) has the molecular formula C11H8Cl2N2O2S2 and a molecular weight of 335.24 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 110864228 |
| Molecular Formula | C11H8Cl2N2O2S2 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 333.94 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetamide |
| SMILES | O=C(CN1C(=O)CSC1=S)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H8Cl2N2O2S2/c12-6-1-7(13)3-8(2-6)14-9(16)4-15-10(17)5-19-11(15)18/h1-3H,4-5H2,(H,14,16) |
| InChIKey | GOSNZCJMPBFJQK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|