C21H16N4O — CID 3746458
2-(benzotriazol-1-yl)-N,3-diphenylprop-2-enamide (PubChem CID 3746458) has the molecular formula C21H16N4O and a molecular weight of 340.39 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-N,3-diphenylprop-2-enamide.
| Compound Name | 2-(benzotriazol-1-yl)-N,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 3746458 |
| Molecular Formula | C21H16N4O |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 2-(benzotriazol-1-yl)-N,3-diphenylprop-2-enamide |
| SMILES | O=C(Nc1ccccc1)C(=Cc1ccccc1)n1nnc2ccccc21 |
| InChI | InChI=1S/C21H16N4O/c26-21(22-17-11-5-2-6-12-17)20(15-16-9-3-1-4-10-16)25-19-14-8-7-13-18(19)23-24-25/h1-15H,(H,22,26) |
| InChIKey | BJMSITABPHLNOA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|