C18H20N6O3S — CID 3750387
N-(3-imidazol-1-ylpropyl)-2-[2-oxo-5-(2-prop-2-enylsulfanyl-3-pyridinyl)-1,3,4-oxadiazol-3-yl]acetamide (PubChem CID 3750387) has the molecular formula C18H20N6O3S and a molecular weight of 400.46 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-2-[2-oxo-5-(2-prop-2-enylsulfanyl-3-pyridinyl)-1,3,4-oxadiazol-3-yl]acetamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-2-[2-oxo-5-(2-prop-2-enylsulfanyl-3-pyridinyl)-1,3,4-oxadiazol-3-yl]acetamide |
|---|---|
| PubChem CID | 3750387 |
| Molecular Formula | C18H20N6O3S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-2-[2-oxo-5-(2-prop-2-enylsulfanyl-3-pyridinyl)-1,3,4-oxadiazol-3-yl]acetamide |
| SMILES | C=CCSc1ncccc1-c1nn(CC(=O)NCCCn2ccnc2)c(=O)o1 |
| InChI | InChI=1S/C18H20N6O3S/c1-2-11-28-17-14(5-3-6-21-17)16-22-24(18(26)27-16)12-15(25)20-7-4-9-23-10-8-19-13-23/h2-3,5-6,8,10,13H,1,4,7,9,11-12H2,(H,20,25) |
| InChIKey | LVCJCTINICQOBR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 107.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|