C23H26N4O5 — CID 3751094
5-[[4-(diethylamino)phenyl]iminomethyl]-1-(2,5-dimethoxyphenyl)-6-hydroxypyrimidine-2,4-dione (PubChem CID 3751094) has the molecular formula C23H26N4O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is 5-[[4-(diethylamino)phenyl]iminomethyl]-1-(2,5-dimethoxyphenyl)-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 5-[[4-(diethylamino)phenyl]iminomethyl]-1-(2,5-dimethoxyphenyl)-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3751094 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 5-[[4-(diethylamino)phenyl]iminomethyl]-1-(2,5-dimethoxyphenyl)-6-hydroxypyrimidine-2,4-dione |
| SMILES | CCN(CC)c1ccc(/N=C/c2c(O)n(-c3cc(OC)ccc3OC)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C23H26N4O5/c1-5-26(6-2)16-9-7-15(8-10-16)24-14-18-21(28)25-23(30)27(22(18)29)19-13-17(31-3)11-12-20(19)32-4/h7-14,29H,5-6H2,1-4H3,(H,25,28,30)/b24-14+ |
| InChIKey | HOVCGSPGLCOMBX-ZVHZXABRSA-N |
| XLogP | 2.85 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|