C19H23FN2O3S — CID 3754185
4-(5-fluoro-2-methylphenyl)sulfonyl-1-(4-methoxyphenyl)-2-methylpiperazine (PubChem CID 3754185) has the molecular formula C19H23FN2O3S and a molecular weight of 378.47 g/mol. Its IUPAC name is 4-(5-fluoro-2-methylphenyl)sulfonyl-1-(4-methoxyphenyl)-2-methylpiperazine.
| Compound Name | 4-(5-fluoro-2-methylphenyl)sulfonyl-1-(4-methoxyphenyl)-2-methylpiperazine |
|---|---|
| PubChem CID | 3754185 |
| Molecular Formula | C19H23FN2O3S |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 4-(5-fluoro-2-methylphenyl)sulfonyl-1-(4-methoxyphenyl)-2-methylpiperazine |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)c3cc(F)ccc3C)CC2C)cc1 |
| InChI | InChI=1S/C19H23FN2O3S/c1-14-4-5-16(20)12-19(14)26(23,24)21-10-11-22(15(2)13-21)17-6-8-18(25-3)9-7-17/h4-9,12,15H,10-11,13H2,1-3H3 |
| InChIKey | PFVNHYUGGBUMCV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|