C28H18FN3O2 — CID 3754799
4-(2-fluorophenyl)-2-[2-(3-methoxyanilino)ethenyl]-5-oxoindeno[1,2-b]pyridine-3-carbonitrile (PubChem CID 3754799) has the molecular formula C28H18FN3O2 and a molecular weight of 447.47 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-2-[2-(3-methoxyanilino)ethenyl]-5-oxoindeno[1,2-b]pyridine-3-carbonitrile.
| Compound Name | 4-(2-fluorophenyl)-2-[2-(3-methoxyanilino)ethenyl]-5-oxoindeno[1,2-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3754799 |
| Molecular Formula | C28H18FN3O2 |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 4-(2-fluorophenyl)-2-[2-(3-methoxyanilino)ethenyl]-5-oxoindeno[1,2-b]pyridine-3-carbonitrile |
| SMILES | COc1cccc(NC=Cc2nc3c(c(-c4ccccc4F)c2C#N)C(=O)c2ccccc2-3)c1 |
| InChI | InChI=1S/C28H18FN3O2/c1-34-18-8-6-7-17(15-18)31-14-13-24-22(16-30)25(21-11-4-5-12-23(21)29)26-27(32-24)19-9-2-3-10-20(19)28(26)33/h2-15,31H,1H3 |
| InChIKey | XMJADWCYIUFSKA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|