C30H21FN2O4 — CID 3627872
2-[2-(4-fluorophenyl)ethenyl]-5-oxo-4-(3,4,5-trimethoxyphenyl)indeno[1,2-b]pyridine-3-carbonitrile (PubChem CID 3627872) has the molecular formula C30H21FN2O4 and a molecular weight of 492.51 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)ethenyl]-5-oxo-4-(3,4,5-trimethoxyphenyl)indeno[1,2-b]pyridine-3-carbonitrile.
| Compound Name | 2-[2-(4-fluorophenyl)ethenyl]-5-oxo-4-(3,4,5-trimethoxyphenyl)indeno[1,2-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3627872 |
| Molecular Formula | C30H21FN2O4 |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 2-[2-(4-fluorophenyl)ethenyl]-5-oxo-4-(3,4,5-trimethoxyphenyl)indeno[1,2-b]pyridine-3-carbonitrile |
| SMILES | COc1cc(-c2c(C#N)c(C=Cc3ccc(F)cc3)nc3c2C(=O)c2ccccc2-3)cc(OC)c1OC |
| InChI | InChI=1S/C30H21FN2O4/c1-35-24-14-18(15-25(36-2)30(24)37-3)26-22(16-32)23(13-10-17-8-11-19(31)12-9-17)33-28-20-6-4-5-7-21(20)29(34)27(26)28/h4-15H,1-3H3 |
| InChIKey | ZXXLTHKZGIXIFE-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 81.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|