C29H30O12 — CID 3757632
[3,4,5-triacetyloxy-6-[(4-oxo-2-phenyl-2,3-dihydrochromen-7-yl)oxy]oxan-2-yl]methyl acetate (PubChem CID 3757632) has the molecular formula C29H30O12 and a molecular weight of 570.55 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[(4-oxo-2-phenyl-2,3-dihydrochromen-7-yl)oxy]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[(4-oxo-2-phenyl-2,3-dihydrochromen-7-yl)oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 3757632 |
| Molecular Formula | C29H30O12 |
| Molecular Weight | 570.55 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[(4-oxo-2-phenyl-2,3-dihydrochromen-7-yl)oxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Oc2ccc3c(c2)OC(c2ccccc2)CC3=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C29H30O12/c1-15(30)35-14-25-26(36-16(2)31)27(37-17(3)32)28(38-18(4)33)29(41-25)39-20-10-11-21-22(34)13-23(40-24(21)12-20)19-8-6-5-7-9-19/h5-12,23,25-29H,13-14H2,1-4H3 |
| InChIKey | MRVBLZQUXRAVSE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.55 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|