C14H8N2O6 — CID 3757948
3-[2-(furan-2-yl)-2-hydroxyethenyl]-7-nitro-1,4-benzoxazin-2-one (PubChem CID 3757948) has the molecular formula C14H8N2O6 and a molecular weight of 300.23 g/mol. Its IUPAC name is 3-[2-(furan-2-yl)-2-hydroxyethenyl]-7-nitro-1,4-benzoxazin-2-one.
| Compound Name | 3-[2-(furan-2-yl)-2-hydroxyethenyl]-7-nitro-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 3757948 |
| Molecular Formula | C14H8N2O6 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 3-[2-(furan-2-yl)-2-hydroxyethenyl]-7-nitro-1,4-benzoxazin-2-one |
| SMILES | O=c1oc2cc([N+](=O)[O-])ccc2nc1C=C(O)c1ccco1 |
| InChI | InChI=1S/C14H8N2O6/c17-11(12-2-1-5-21-12)7-10-14(18)22-13-6-8(16(19)20)3-4-9(13)15-10/h1-7,17H |
| InChIKey | BFXYVPXEZDWFSU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|