C14H14N2O5 — CID 135432680
3-[(Z)-2-hydroxy-3,3-dimethylbut-1-enyl]-6-nitro-1,4-benzoxazin-2-one (PubChem CID 135432680) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is 3-[(Z)-2-hydroxy-3,3-dimethylbut-1-enyl]-6-nitro-1,4-benzoxazin-2-one.
| Compound Name | 3-[(Z)-2-hydroxy-3,3-dimethylbut-1-enyl]-6-nitro-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 135432680 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 3-[(Z)-2-hydroxy-3,3-dimethylbut-1-enyl]-6-nitro-1,4-benzoxazin-2-one |
| SMILES | CC(C)(C)/C(O)=C/c1nc2cc([N+](=O)[O-])ccc2oc1=O |
| InChI | InChI=1S/C14H14N2O5/c1-14(2,3)12(17)7-10-13(18)21-11-5-4-8(16(19)20)6-9(11)15-10/h4-7,17H,1-3H3/b12-7- |
| InChIKey | JYSGMGVVSFIHEE-GHXNOFRVSA-N |
| XLogP | 3.04 |
| TPSA | 106.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|