C8H8N5O3+ — CID 4206747
diaminomethylidene-(5-nitro-1,3-benzoxazol-2-yl)azanium (PubChem CID 4206747) has the molecular formula C8H8N5O3+ and a molecular weight of 222.18 g/mol. Its IUPAC name is diaminomethylidene-(5-nitro-1,3-benzoxazol-2-yl)azanium.
| Compound Name | diaminomethylidene-(5-nitro-1,3-benzoxazol-2-yl)azanium |
|---|---|
| PubChem CID | 4206747 |
| Molecular Formula | C8H8N5O3+ |
| Molecular Weight | 222.18 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | diaminomethylidene-(5-nitro-1,3-benzoxazol-2-yl)azanium |
| SMILES | NC(N)=[NH+]c1nc2cc([N+](=O)[O-])ccc2o1 |
| InChI | InChI=1S/C8H7N5O3/c9-7(10)12-8-11-5-3-4(13(14)15)1-2-6(5)16-8/h1-3H,(H4,9,10,11,12)/p+1 |
| InChIKey | NIFGELXGXJWBEK-UHFFFAOYSA-O |
| XLogP | -1.28 |
| TPSA | 135.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.18 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|