C15H11N3O6 — CID 3911721
3-[2-(2,4-dimethyl-1,3-oxazol-5-yl)-2-hydroxyethenyl]-7-nitro-1,4-benzoxazin-2-one (PubChem CID 3911721) has the molecular formula C15H11N3O6 and a molecular weight of 329.27 g/mol. Its IUPAC name is 3-[2-(2,4-dimethyl-1,3-oxazol-5-yl)-2-hydroxyethenyl]-7-nitro-1,4-benzoxazin-2-one.
| Compound Name | 3-[2-(2,4-dimethyl-1,3-oxazol-5-yl)-2-hydroxyethenyl]-7-nitro-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 3911721 |
| Molecular Formula | C15H11N3O6 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 3-[2-(2,4-dimethyl-1,3-oxazol-5-yl)-2-hydroxyethenyl]-7-nitro-1,4-benzoxazin-2-one |
| SMILES | Cc1nc(C)c(C(O)=Cc2nc3ccc([N+](=O)[O-])cc3oc2=O)o1 |
| InChI | InChI=1S/C15H11N3O6/c1-7-14(23-8(2)16-7)12(19)6-11-15(20)24-13-5-9(18(21)22)3-4-10(13)17-11/h3-6,19H,1-2H3 |
| InChIKey | UAVQRJBGCQUDEZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|