C8H9Br2NO4S2 — CID 3759616
ethyl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]acetate (PubChem CID 3759616) has the molecular formula C8H9Br2NO4S2 and a molecular weight of 407.11 g/mol. Its IUPAC name is ethyl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]acetate.
| Compound Name | ethyl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 3759616 |
| Molecular Formula | C8H9Br2NO4S2 |
| Molecular Weight | 407.11 g/mol |
| Exact Mass | 404.83 |
| IUPAC Name | ethyl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]acetate |
| SMILES | CCOC(=O)CNS(=O)(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C8H9Br2NO4S2/c1-2-15-6(12)4-11-17(13,14)7-3-5(9)8(10)16-7/h3,11H,2,4H2,1H3 |
| InChIKey | OSSWLXABBVACCO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.11 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |