C19H21NO2 — CID 3766962
6,7-dimethoxy-1-(2-phenylethyl)-3,4-dihydroisoquinoline (PubChem CID 3766962) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 6,7-dimethoxy-1-(2-phenylethyl)-3,4-dihydroisoquinoline.
| Compound Name | 6,7-dimethoxy-1-(2-phenylethyl)-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 3766962 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 6,7-dimethoxy-1-(2-phenylethyl)-3,4-dihydroisoquinoline |
| SMILES | COc1cc2c(cc1OC)C(CCc1ccccc1)=NCC2 |
| InChI | InChI=1S/C19H21NO2/c1-21-18-12-15-10-11-20-17(16(15)13-19(18)22-2)9-8-14-6-4-3-5-7-14/h3-7,12-13H,8-11H2,1-2H3 |
| InChIKey | OVLGDRCDLSLUAP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |