C11H13NO2 — CID 30058
6,7-dimethoxy-3,4-dihydroisoquinoline (PubChem CID 30058) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 6,7-dimethoxy-3,4-dihydroisoquinoline.
| Compound Name | 6,7-dimethoxy-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 30058 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 6,7-dimethoxy-3,4-dihydroisoquinoline |
| SMILES | COc1cc2c(cc1OC)CCN=C2 |
| InChI | InChI=1S/C11H13NO2/c1-13-10-5-8-3-4-12-7-9(8)6-11(10)14-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | NSLJVQUDZCZJLK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |