About 5-acetyl-3-amino-4-(4-butoxyphenyl)-6-methyl-4,7-dihydrothieno[2,3-b]pyridine-2-carbonitrile
5-acetyl-3-amino-4-(4-butoxyphenyl)-6-methyl-4,7-dihydrothieno[2,3-b]pyridine-2-carbonitrile (PubChem CID 3770953) has the molecular formula C21H23N3O2S
and a molecular weight of 381.50 g/mol. Its IUPAC name is 5-acetyl-3-amino-4-(4-butoxyphenyl)-6-methyl-4,7-dihydrothieno[2,3-b]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 5-acetyl-3-amino-4-(4-butoxyphenyl)-6-methyl-4,7-dihydrothieno[2,3-b]pyridine-2-carbonitrile |
| PubChem CID | 3770953 |
| Molecular Formula | C21H23N3O2S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 5-acetyl-3-amino-4-(4-butoxyphenyl)-6-methyl-4,7-dihydrothieno[2,3-b]pyridine-2-carbonitrile |
| SMILES | CCCCOc1ccc(C2C(C(C)=O)=C(C)Nc3sc(C#N)c(N)c32)cc1 |
| InChI | InChI=1S/C21H23N3O2S/c1-4-5-10-26-15-8-6-14(7-9-15)18-17(13(3)25)12(2)24-21-19(18)20(23)16(11-22)27-21/h6-9,18,24H,4-5,10,23H2,1-3H3 |
| InChIKey | ULEOIBMVJSRCBU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-acetyl-3-amino-4-(4-butoxyphenyl)-6-methyl-4,7-dihydrothieno[2,3-b]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-3-amino-4-(4-butoxyphenyl)-6-methyl-4,7-dihydrothieno[2,3-b]pyridine-2-carbonitrile?
The IUPAC name of 5-acetyl-3-amino-4-(4-butoxyphenyl)-6-methyl-4,7-dihydrothieno[2,3-b]pyridine-2-carbonitrile (CID 3770953) is 5-acetyl-3-amino-4-(4-butoxyphenyl)-6-methyl-4,7-dihydrothieno[2,3-b]pyridine-2-carbonitrile.
What is the SMILES notation for 5-acetyl-3-amino-4-(4-butoxyphenyl)-6-methyl-4,7-dihydrothieno[2,3-b]pyridine-2-carbonitrile?
The canonical SMILES for 5-acetyl-3-amino-4-(4-butoxyphenyl)-6-methyl-4,7-dihydrothieno[2,3-b]pyridine-2-carbonitrile is CCCCOc1ccc(C2C(C(C)=O)=C(C)Nc3sc(C#N)c(N)c32)cc1.
What is the InChIKey of 5-acetyl-3-amino-4-(4-butoxyphenyl)-6-methyl-4,7-dihydrothieno[2,3-b]pyridine-2-carbonitrile?
The InChIKey is ULEOIBMVJSRCBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O2S/c1-4-5-10-26-15-8-6-14(7-9-15)18-17(13(3)25)12(2)24-21-19(18)20(23)16(11-22)27-21/h6-9,18,24H,4-5,10,23H2,1-3H3.
What are the key properties of 5-acetyl-3-amino-4-(4-butoxyphenyl)-6-methyl-4,7-dihydrothieno[2,3-b]pyridine-2-carbonitrile?
5-acetyl-3-amino-4-(4-butoxyphenyl)-6-methyl-4,7-dihydrothieno[2,3-b]pyridine-2-carbonitrile has a molecular weight of 381.50 g/mol, XLogP of 4.80, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-3-amino-4-(4-butoxyphenyl)-6-methyl-4,7-dihydrothieno[2,3-b]pyridine-2-carbonitrile is sourced from PubChem (CID 3770953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).