C17H23N5O6 — CID 3778997
ethyl 1-[5-(3-hydroxypropylamino)-4-nitro-2,1,3-benzoxadiazol-7-yl]piperidine-2-carboxylate (PubChem CID 3778997) has the molecular formula C17H23N5O6 and a molecular weight of 393.40 g/mol. Its IUPAC name is ethyl 1-[5-(3-hydroxypropylamino)-4-nitro-2,1,3-benzoxadiazol-7-yl]piperidine-2-carboxylate.
| Compound Name | ethyl 1-[5-(3-hydroxypropylamino)-4-nitro-2,1,3-benzoxadiazol-7-yl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 3778997 |
| Molecular Formula | C17H23N5O6 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | ethyl 1-[5-(3-hydroxypropylamino)-4-nitro-2,1,3-benzoxadiazol-7-yl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1c1cc(NCCCO)c([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C17H23N5O6/c1-2-27-17(24)12-6-3-4-8-21(12)13-10-11(18-7-5-9-23)16(22(25)26)15-14(13)19-28-20-15/h10,12,18,23H,2-9H2,1H3 |
| InChIKey | QPWIWSGNJNYCCH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|