C10H5N3O3S2 — CID 3780727
6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 3780727) has the molecular formula C10H5N3O3S2 and a molecular weight of 279.30 g/mol. Its IUPAC name is 6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 3780727 |
| Molecular Formula | C10H5N3O3S2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 278.98 |
| IUPAC Name | 6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C1CSC(=S)N1N1C(=O)c2cccnc2C1=O |
| InChI | InChI=1S/C10H5N3O3S2/c14-6-4-18-10(17)12(6)13-8(15)5-2-1-3-11-7(5)9(13)16/h1-3H,4H2 |
| InChIKey | OBWAAYKORWQSCL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|