C21H25N5O2 — CID 3790076
6-butyl-8-ethyl-2,4-dimethyl-7-phenylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 3790076) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 6-butyl-8-ethyl-2,4-dimethyl-7-phenylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-butyl-8-ethyl-2,4-dimethyl-7-phenylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 3790076 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 6-butyl-8-ethyl-2,4-dimethyl-7-phenylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | CCCCn1c(-c2ccccc2)c(CC)n2c3c(=O)n(C)c(=O)n(C)c3nc12 |
| InChI | InChI=1S/C21H25N5O2/c1-5-7-13-25-16(14-11-9-8-10-12-14)15(6-2)26-17-18(22-20(25)26)23(3)21(28)24(4)19(17)27/h8-12H,5-7,13H2,1-4H3 |
| InChIKey | MXHFTGAKAIELKJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |