C25H25N5O2 — CID 16765140
8-butyl-2,4-dimethyl-6,7-diphenylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 16765140) has the molecular formula C25H25N5O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 8-butyl-2,4-dimethyl-6,7-diphenylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 8-butyl-2,4-dimethyl-6,7-diphenylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 16765140 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 8-butyl-2,4-dimethyl-6,7-diphenylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | CCCCc1c(-c2ccccc2)n(-c2ccccc2)c2nc3c(c(=O)n(C)c(=O)n3C)n12 |
| InChI | InChI=1S/C25H25N5O2/c1-4-5-16-19-20(17-12-8-6-9-13-17)29(18-14-10-7-11-15-18)24-26-22-21(30(19)24)23(31)28(3)25(32)27(22)2/h6-15H,4-5,16H2,1-3H3 |
| InChIKey | XBCSNLQFTNSPKA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |