C16H24N2O2S — CID 3790416
2-(5-methylfuran-2-yl)-3-(4-pyrrolidin-1-ylbutyl)-1,3-thiazolidin-4-one (PubChem CID 3790416) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is 2-(5-methylfuran-2-yl)-3-(4-pyrrolidin-1-ylbutyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(5-methylfuran-2-yl)-3-(4-pyrrolidin-1-ylbutyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3790416 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-(5-methylfuran-2-yl)-3-(4-pyrrolidin-1-ylbutyl)-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(C2SCC(=O)N2CCCCN2CCCC2)o1 |
| InChI | InChI=1S/C16H24N2O2S/c1-13-6-7-14(20-13)16-18(15(19)12-21-16)11-5-4-10-17-8-2-3-9-17/h6-7,16H,2-5,8-12H2,1H3 |
| InChIKey | KWQIMRIDNQZRAS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|