C6H12N2O4 — CID 3792964
N-(2,3-dihydroxypropyl)-N-(2-oxopropyl)nitrous amide (PubChem CID 3792964) has the molecular formula C6H12N2O4 and a molecular weight of 176.17 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-N-(2-oxopropyl)nitrous amide.
| Compound Name | N-(2,3-dihydroxypropyl)-N-(2-oxopropyl)nitrous amide |
|---|---|
| PubChem CID | 3792964 |
| Molecular Formula | C6H12N2O4 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-N-(2-oxopropyl)nitrous amide |
| SMILES | CC(=O)CN(CC(O)CO)N=O |
| InChI | InChI=1S/C6H12N2O4/c1-5(10)2-8(7-12)3-6(11)4-9/h6,9,11H,2-4H2,1H3 |
| InChIKey | LUVOLNSYNLKFKR-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|