C32H33N3O3 — CID 3793386
4-phenoxy-1-[2-[5-(2-phenylethynyl)pyridine-3-carbonyl]-2,8-diazaspiro[4.5]decan-8-yl]butan-1-one (PubChem CID 3793386) has the molecular formula C32H33N3O3 and a molecular weight of 507.63 g/mol. Its IUPAC name is 4-phenoxy-1-[2-[5-(2-phenylethynyl)pyridine-3-carbonyl]-2,8-diazaspiro[4.5]decan-8-yl]butan-1-one.
| Compound Name | 4-phenoxy-1-[2-[5-(2-phenylethynyl)pyridine-3-carbonyl]-2,8-diazaspiro[4.5]decan-8-yl]butan-1-one |
|---|---|
| PubChem CID | 3793386 |
| Molecular Formula | C32H33N3O3 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | 4-phenoxy-1-[2-[5-(2-phenylethynyl)pyridine-3-carbonyl]-2,8-diazaspiro[4.5]decan-8-yl]butan-1-one |
| SMILES | O=C(CCCOc1ccccc1)N1CCC2(CC1)CCN(C(=O)c1cncc(C#Cc3ccccc3)c1)C2 |
| InChI | InChI=1S/C32H33N3O3/c36-30(12-7-21-38-29-10-5-2-6-11-29)34-18-15-32(16-19-34)17-20-35(25-32)31(37)28-22-27(23-33-24-28)14-13-26-8-3-1-4-9-26/h1-6,8-11,22-24H,7,12,15-21,25H2 |
| InChIKey | QQQXDQXXXOQCIO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|