C26H35N3O2S — CID 3842939
N-(2-bicyclo[2.2.1]hept-5-enyl)-8-(4-phenoxybutanoyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide (PubChem CID 3842939) has the molecular formula C26H35N3O2S and a molecular weight of 453.65 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enyl)-8-(4-phenoxybutanoyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enyl)-8-(4-phenoxybutanoyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
|---|---|
| PubChem CID | 3842939 |
| Molecular Formula | C26H35N3O2S |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enyl)-8-(4-phenoxybutanoyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
| SMILES | O=C(CCCOc1ccccc1)N1CCC2(CC1)CCN(C(=S)NC1CC3C=CC1C3)C2 |
| InChI | InChI=1S/C26H35N3O2S/c30-24(7-4-16-31-22-5-2-1-3-6-22)28-13-10-26(11-14-28)12-15-29(19-26)25(32)27-23-18-20-8-9-21(23)17-20/h1-3,5-6,8-9,20-21,23H,4,7,10-19H2,(H,27,32) |
| InChIKey | JRSVLLKIQCMONN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|