C26H26N2OS — CID 3795524
5-ethyl-2-methyl-4-(4-phenylphenyl)-1-(2-thiophen-2-ylethyl)pyrrole-3-carboxamide (PubChem CID 3795524) has the molecular formula C26H26N2OS and a molecular weight of 414.57 g/mol. Its IUPAC name is 5-ethyl-2-methyl-4-(4-phenylphenyl)-1-(2-thiophen-2-ylethyl)pyrrole-3-carboxamide.
| Compound Name | 5-ethyl-2-methyl-4-(4-phenylphenyl)-1-(2-thiophen-2-ylethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3795524 |
| Molecular Formula | C26H26N2OS |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 5-ethyl-2-methyl-4-(4-phenylphenyl)-1-(2-thiophen-2-ylethyl)pyrrole-3-carboxamide |
| SMILES | CCc1c(-c2ccc(-c3ccccc3)cc2)c(C(N)=O)c(C)n1CCc1cccs1 |
| InChI | InChI=1S/C26H26N2OS/c1-3-23-25(21-13-11-20(12-14-21)19-8-5-4-6-9-19)24(26(27)29)18(2)28(23)16-15-22-10-7-17-30-22/h4-14,17H,3,15-16H2,1-2H3,(H2,27,29) |
| InChIKey | ZPCOKDZGPJUXFY-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |