C23H28N2OS — CID 3756089
5-butyl-2-methyl-4-(4-methylphenyl)-1-(2-thiophen-2-ylethyl)pyrrole-3-carboxamide (PubChem CID 3756089) has the molecular formula C23H28N2OS and a molecular weight of 380.56 g/mol. Its IUPAC name is 5-butyl-2-methyl-4-(4-methylphenyl)-1-(2-thiophen-2-ylethyl)pyrrole-3-carboxamide.
| Compound Name | 5-butyl-2-methyl-4-(4-methylphenyl)-1-(2-thiophen-2-ylethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3756089 |
| Molecular Formula | C23H28N2OS |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 5-butyl-2-methyl-4-(4-methylphenyl)-1-(2-thiophen-2-ylethyl)pyrrole-3-carboxamide |
| SMILES | CCCCc1c(-c2ccc(C)cc2)c(C(N)=O)c(C)n1CCc1cccs1 |
| InChI | InChI=1S/C23H28N2OS/c1-4-5-8-20-22(18-11-9-16(2)10-12-18)21(23(24)26)17(3)25(20)14-13-19-7-6-15-27-19/h6-7,9-12,15H,4-5,8,13-14H2,1-3H3,(H2,24,26) |
| InChIKey | WJDRMFNJEYRGFX-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |