C14H14N2OS — CID 3795905
4-methyl-2-phenyl-N-prop-2-enyl-1,3-thiazole-5-carboxamide (PubChem CID 3795905) has the molecular formula C14H14N2OS and a molecular weight of 258.35 g/mol. Its IUPAC name is 4-methyl-2-phenyl-N-prop-2-enyl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-2-phenyl-N-prop-2-enyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 3795905 |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 4-methyl-2-phenyl-N-prop-2-enyl-1,3-thiazole-5-carboxamide |
| SMILES | C=CCNC(=O)c1sc(-c2ccccc2)nc1C |
| InChI | InChI=1S/C14H14N2OS/c1-3-9-15-13(17)12-10(2)16-14(18-12)11-7-5-4-6-8-11/h3-8H,1,9H2,2H3,(H,15,17) |
| InChIKey | JHIPDWUEAWXRRB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|