C21H29N3O7S2 — CID 3796512
N-(2,6-dimethoxy-3-pyridinyl)-4-(dipropylsulfamoyl)-N-methylsulfonylbenzamide (PubChem CID 3796512) has the molecular formula C21H29N3O7S2 and a molecular weight of 499.61 g/mol. Its IUPAC name is N-(2,6-dimethoxy-3-pyridinyl)-4-(dipropylsulfamoyl)-N-methylsulfonylbenzamide.
| Compound Name | N-(2,6-dimethoxy-3-pyridinyl)-4-(dipropylsulfamoyl)-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 3796512 |
| Molecular Formula | C21H29N3O7S2 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | N-(2,6-dimethoxy-3-pyridinyl)-4-(dipropylsulfamoyl)-N-methylsulfonylbenzamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)N(c2ccc(OC)nc2OC)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H29N3O7S2/c1-6-14-23(15-7-2)33(28,29)17-10-8-16(9-11-17)21(25)24(32(5,26)27)18-12-13-19(30-3)22-20(18)31-4/h8-13H,6-7,14-15H2,1-5H3 |
| InChIKey | CJSGGROQVUMPGH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 123.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |