C23H25N3O3 — CID 3796868
5-[N-(3,3-diphenylpropyl)-C-methylcarbonimidoyl]-6-hydroxy-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 3796868) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 5-[N-(3,3-diphenylpropyl)-C-methylcarbonimidoyl]-6-hydroxy-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 5-[N-(3,3-diphenylpropyl)-C-methylcarbonimidoyl]-6-hydroxy-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3796868 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 5-[N-(3,3-diphenylpropyl)-C-methylcarbonimidoyl]-6-hydroxy-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | C/C(=N\CCC(c1ccccc1)c1ccccc1)c1c(O)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C23H25N3O3/c1-16(20-21(27)25(2)23(29)26(3)22(20)28)24-15-14-19(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,19,27H,14-15H2,1-3H3/b24-16+ |
| InChIKey | CNFLGIXZHLOKAS-LFVJCYFKSA-N |
| XLogP | 2.82 |
| TPSA | 76.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|