C18H26N4OS — CID 3800581
N-(benzotriazole-1-carbothioyl)-4,8-dimethylnonanamide (PubChem CID 3800581) has the molecular formula C18H26N4OS and a molecular weight of 346.50 g/mol. Its IUPAC name is N-(benzotriazole-1-carbothioyl)-4,8-dimethylnonanamide.
| Compound Name | N-(benzotriazole-1-carbothioyl)-4,8-dimethylnonanamide |
|---|---|
| PubChem CID | 3800581 |
| Molecular Formula | C18H26N4OS |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | N-(benzotriazole-1-carbothioyl)-4,8-dimethylnonanamide |
| SMILES | CC(C)CCCC(C)CCC(=O)NC(=S)n1nnc2ccccc21 |
| InChI | InChI=1S/C18H26N4OS/c1-13(2)7-6-8-14(3)11-12-17(23)19-18(24)22-16-10-5-4-9-15(16)20-21-22/h4-5,9-10,13-14H,6-8,11-12H2,1-3H3,(H,19,23,24) |
| InChIKey | QIUIOFTVPSLPME-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|