C11H12N6OS — CID 3800920
N-[1-(4-cyanobutyl)pyrazol-4-yl]thiadiazole-4-carboxamide (PubChem CID 3800920) has the molecular formula C11H12N6OS and a molecular weight of 276.32 g/mol. Its IUPAC name is N-[1-(4-cyanobutyl)pyrazol-4-yl]thiadiazole-4-carboxamide.
| Compound Name | N-[1-(4-cyanobutyl)pyrazol-4-yl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 3800920 |
| Molecular Formula | C11H12N6OS |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | N-[1-(4-cyanobutyl)pyrazol-4-yl]thiadiazole-4-carboxamide |
| SMILES | N#CCCCCn1cc(NC(=O)c2csnn2)cn1 |
| InChI | InChI=1S/C11H12N6OS/c12-4-2-1-3-5-17-7-9(6-13-17)14-11(18)10-8-19-16-15-10/h6-8H,1-3,5H2,(H,14,18) |
| InChIKey | ZCGWVXMGOPQLIF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|