C12H17N5S — CID 4586656
1-[1-(4-cyanobutyl)pyrazol-4-yl]-3-prop-2-enylthiourea (PubChem CID 4586656) has the molecular formula C12H17N5S and a molecular weight of 263.37 g/mol. Its IUPAC name is 1-[1-(4-cyanobutyl)pyrazol-4-yl]-3-prop-2-enylthiourea.
| Compound Name | 1-[1-(4-cyanobutyl)pyrazol-4-yl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 4586656 |
| Molecular Formula | C12H17N5S |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 1-[1-(4-cyanobutyl)pyrazol-4-yl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1cnn(CCCCC#N)c1 |
| InChI | InChI=1S/C12H17N5S/c1-2-7-14-12(18)16-11-9-15-17(10-11)8-5-3-4-6-13/h2,9-10H,1,3-5,7-8H2,(H2,14,16,18) |
| InChIKey | YJZOPASKABABOD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 65.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|