C14H14ClN5O — CID 5006445
6-chloro-N-[1-(4-cyanobutyl)pyrazol-4-yl]pyridine-2-carboxamide (PubChem CID 5006445) has the molecular formula C14H14ClN5O and a molecular weight of 303.75 g/mol. Its IUPAC name is 6-chloro-N-[1-(4-cyanobutyl)pyrazol-4-yl]pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-[1-(4-cyanobutyl)pyrazol-4-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 5006445 |
| Molecular Formula | C14H14ClN5O |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 6-chloro-N-[1-(4-cyanobutyl)pyrazol-4-yl]pyridine-2-carboxamide |
| SMILES | N#CCCCCn1cc(NC(=O)c2cccc(Cl)n2)cn1 |
| InChI | InChI=1S/C14H14ClN5O/c15-13-6-4-5-12(19-13)14(21)18-11-9-17-20(10-11)8-3-1-2-7-16/h4-6,9-10H,1-3,8H2,(H,18,21) |
| InChIKey | BMXADOJYWNQIAN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|