C16H17ClN4O5 — CID 3754878
dimethyl 3-[4-[(6-chloropyridine-2-carbonyl)amino]pyrazol-1-yl]pentanedioate (PubChem CID 3754878) has the molecular formula C16H17ClN4O5 and a molecular weight of 380.79 g/mol. Its IUPAC name is dimethyl 3-[4-[(6-chloropyridine-2-carbonyl)amino]pyrazol-1-yl]pentanedioate.
| Compound Name | dimethyl 3-[4-[(6-chloropyridine-2-carbonyl)amino]pyrazol-1-yl]pentanedioate |
|---|---|
| PubChem CID | 3754878 |
| Molecular Formula | C16H17ClN4O5 |
| Molecular Weight | 380.79 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | dimethyl 3-[4-[(6-chloropyridine-2-carbonyl)amino]pyrazol-1-yl]pentanedioate |
| SMILES | COC(=O)CC(CC(=O)OC)n1cc(NC(=O)c2cccc(Cl)n2)cn1 |
| InChI | InChI=1S/C16H17ClN4O5/c1-25-14(22)6-11(7-15(23)26-2)21-9-10(8-18-21)19-16(24)12-4-3-5-13(17)20-12/h3-5,8-9,11H,6-7H2,1-2H3,(H,19,24) |
| InChIKey | ZUCVTMJDRZSDBE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.79 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|